C14H22N6O — CID 122097338
N'-[[(2R)-oxolan-2-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 122097338) has the molecular formula C14H22N6O and a molecular weight of 290.37 g/mol. Its IUPAC name is N'-[[(2R)-oxolan-2-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[[(2R)-oxolan-2-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122097338 |
| Molecular Formula | C14H22N6O |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | N'-[[(2R)-oxolan-2-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | N/C(=N\C[C@H]1CCCO1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H22N6O/c15-13(18-11-12-3-1-10-21-12)19-6-8-20(9-7-19)14-16-4-2-5-17-14/h2,4-5,12H,1,3,6-11H2,(H2,15,18)/t12-/m1/s1 |
| InChIKey | PFHUUFZFJJRUSB-GFCCVEGCSA-N |
| XLogP | 0.09 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|