C16H24N6O3 — CID 95860515
N-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide (PubChem CID 95860515) has the molecular formula C16H24N6O3 and a molecular weight of 348.41 g/mol. Its IUPAC name is N-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 95860515 |
| Molecular Formula | C16H24N6O3 |
| Molecular Weight | 348.41 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | N-[2-oxo-2-[[(2S)-oxolan-2-yl]methylamino]ethyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(CNC(=O)N1CCN(c2ncccn2)CC1)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C16H24N6O3/c23-14(19-11-13-3-1-10-25-13)12-20-16(24)22-8-6-21(7-9-22)15-17-4-2-5-18-15/h2,4-5,13H,1,3,6-12H2,(H,19,23)(H,20,24)/t13-/m0/s1 |
| InChIKey | YCNAUMXWXKCXTE-ZDUSSCGKSA-N |
| XLogP | -0.40 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.41 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |