C14H21N5O2 — CID 94124309
N-[[(3S)-oxolan-3-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide (PubChem CID 94124309) has the molecular formula C14H21N5O2 and a molecular weight of 291.35 g/mol. Its IUPAC name is N-[[(3S)-oxolan-3-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide.
| Compound Name | N-[[(3S)-oxolan-3-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
|---|---|
| PubChem CID | 94124309 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | N-[[(3S)-oxolan-3-yl]methyl]-4-pyrimidin-2-ylpiperazine-1-carboxamide |
| SMILES | O=C(NC[C@@H]1CCOC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C14H21N5O2/c20-14(17-10-12-2-9-21-11-12)19-7-5-18(6-8-19)13-15-3-1-4-16-13/h1,3-4,12H,2,5-11H2,(H,17,20)/t12-/m0/s1 |
| InChIKey | DZMXKQJOOSICLJ-LBPRGKRZSA-N |
| XLogP | 0.34 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |