C19H27N3O3 — CID 136578291
4-benzoyl-N-(oxan-3-ylmethyl)-1,4-diazepane-1-carboxamide (PubChem CID 136578291) has the molecular formula C19H27N3O3 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-benzoyl-N-(oxan-3-ylmethyl)-1,4-diazepane-1-carboxamide.
| Compound Name | 4-benzoyl-N-(oxan-3-ylmethyl)-1,4-diazepane-1-carboxamide |
|---|---|
| PubChem CID | 136578291 |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 4-benzoyl-N-(oxan-3-ylmethyl)-1,4-diazepane-1-carboxamide |
| SMILES | O=C(NCC1CCCOC1)N1CCCN(C(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C19H27N3O3/c23-18(17-7-2-1-3-8-17)21-9-5-10-22(12-11-21)19(24)20-14-16-6-4-13-25-15-16/h1-3,7-8,16H,4-6,9-15H2,(H,20,24) |
| InChIKey | MNFKZKPGPAFYEG-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |