C16H26N6O2 — CID 122097394
N'-[(3-methoxyoxan-4-yl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide (PubChem CID 122097394) has the molecular formula C16H26N6O2 and a molecular weight of 334.42 g/mol. Its IUPAC name is N'-[(3-methoxyoxan-4-yl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide.
| Compound Name | N'-[(3-methoxyoxan-4-yl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 122097394 |
| Molecular Formula | C16H26N6O2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | N'-[(3-methoxyoxan-4-yl)methyl]-4-pyrimidin-2-ylpiperazine-1-carboximidamide |
| SMILES | COC1COCCC1C/N=C(\N)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C16H26N6O2/c1-23-14-12-24-10-3-13(14)11-20-15(17)21-6-8-22(9-7-21)16-18-4-2-5-19-16/h2,4-5,13-14H,3,6-12H2,1H3,(H2,17,20) |
| InChIKey | ZVFVTAUZBBTWGA-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|