C20H30IN7S — CID 119120543
4-pyrimidin-2-yl-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 119120543) has the molecular formula C20H30IN7S and a molecular weight of 527.48 g/mol. Its IUPAC name is 4-pyrimidin-2-yl-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-pyrimidin-2-yl-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 119120543 |
| Molecular Formula | C20H30IN7S |
| Molecular Weight | 527.48 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 4-pyrimidin-2-yl-N'-[[1-(thiophen-2-ylmethyl)piperidin-4-yl]methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(Cc2cccs2)CC1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C20H29N7S.HI/c21-19(26-10-12-27(13-11-26)20-22-6-2-7-23-20)24-15-17-4-8-25(9-5-17)16-18-3-1-14-28-18;/h1-3,6-7,14,17H,4-5,8-13,15-16H2,(H2,21,24);1H |
| InChIKey | UVMRNUKTRGYJLQ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 73.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.48 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|