C10H18Cl2N2S — CID 22748866
1-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride (PubChem CID 22748866) has the molecular formula C10H18Cl2N2S and a molecular weight of 269.24 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride.
| Compound Name | 1-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride |
|---|---|
| PubChem CID | 22748866 |
| Molecular Formula | C10H18Cl2N2S |
| Molecular Weight | 269.24 g/mol |
| Exact Mass | 268.06 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)piperidin-4-amine;dihydrochloride |
| SMILES | Cl.Cl.NC1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C10H16N2S.2ClH/c11-9-3-5-12(6-4-9)8-10-2-1-7-13-10;;/h1-2,7,9H,3-6,8,11H2;2*1H |
| InChIKey | ZAAXJLLSINHSKH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.24 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |