C19H26N2S2 — CID 97370579
3,9-bis(thiophen-2-ylmethyl)-3,9-diazaspiro[5.5]undecane (PubChem CID 97370579) has the molecular formula C19H26N2S2 and a molecular weight of 346.56 g/mol. Its IUPAC name is 3,9-bis(thiophen-2-ylmethyl)-3,9-diazaspiro[5.5]undecane.
| Compound Name | 3,9-bis(thiophen-2-ylmethyl)-3,9-diazaspiro[5.5]undecane |
|---|---|
| PubChem CID | 97370579 |
| Molecular Formula | C19H26N2S2 |
| Molecular Weight | 346.56 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | 3,9-bis(thiophen-2-ylmethyl)-3,9-diazaspiro[5.5]undecane |
| SMILES | c1csc(CN2CCC3(CC2)CCN(Cc2cccs2)CC3)c1 |
| InChI | InChI=1S/C19H26N2S2/c1-3-17(22-13-1)15-20-9-5-19(6-10-20)7-11-21(12-8-19)16-18-4-2-14-23-18/h1-4,13-14H,5-12,15-16H2 |
| InChIKey | GKWNYQFOBIJVKO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.56 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |