C12H19NOS — CID 104695288
[4-methyl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanol (PubChem CID 104695288) has the molecular formula C12H19NOS and a molecular weight of 225.36 g/mol. Its IUPAC name is [4-methyl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanol.
| Compound Name | [4-methyl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanol |
|---|---|
| PubChem CID | 104695288 |
| Molecular Formula | C12H19NOS |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.12 |
| IUPAC Name | [4-methyl-1-(thiophen-2-ylmethyl)piperidin-4-yl]methanol |
| SMILES | CC1(CO)CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C12H19NOS/c1-12(10-14)4-6-13(7-5-12)9-11-3-2-8-15-11/h2-3,8,14H,4-7,9-10H2,1H3 |
| InChIKey | BFTDVEGLIGWSDR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |