C11H12F3NO2S — CID 63710730
1-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63710730) has the molecular formula C11H12F3NO2S and a molecular weight of 279.28 g/mol. Its IUPAC name is 1-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63710730 |
| Molecular Formula | C11H12F3NO2S |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.05 |
| IUPAC Name | 1-(thiophen-2-ylmethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)CCN(Cc2cccs2)C1 |
| InChI | InChI=1S/C11H12F3NO2S/c12-11(13,14)10(9(16)17)3-4-15(7-10)6-8-2-1-5-18-8/h1-2,5H,3-4,6-7H2,(H,16,17) |
| InChIKey | QJCDMAHIWMQQFE-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |