C11H11BrF3NO2S — CID 63709452
1-[(5-bromothiophen-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63709452) has the molecular formula C11H11BrF3NO2S and a molecular weight of 358.18 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63709452 |
| Molecular Formula | C11H11BrF3NO2S |
| Molecular Weight | 358.18 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)CCN(Cc2ccc(Br)s2)C1 |
| InChI | InChI=1S/C11H11BrF3NO2S/c12-8-2-1-7(19-8)5-16-4-3-10(6-16,9(17)18)11(13,14)15/h1-2H,3-6H2,(H,17,18) |
| InChIKey | JSVLOAPUEVARLU-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.18 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |