C13H12BrF4NO2 — CID 63708560
1-[(2-bromo-5-fluorophenyl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63708560) has the molecular formula C13H12BrF4NO2 and a molecular weight of 370.14 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63708560 |
| Molecular Formula | C13H12BrF4NO2 |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.00 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)CCN(Cc2cc(F)ccc2Br)C1 |
| InChI | InChI=1S/C13H12BrF4NO2/c14-10-2-1-9(15)5-8(10)6-19-4-3-12(7-19,11(20)21)13(16,17)18/h1-2,5H,3-4,6-7H2,(H,20,21) |
| InChIKey | GPCKXUTVQPLJSO-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |