C13H14F4N2O2 — CID 107321153
3-amino-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid (PubChem CID 107321153) has the molecular formula C13H14F4N2O2 and a molecular weight of 306.26 g/mol. Its IUPAC name is 3-amino-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107321153 |
| Molecular Formula | C13H14F4N2O2 |
| Molecular Weight | 306.26 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | 3-amino-1-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(Cc2ccc(F)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C13H14F4N2O2/c14-9-2-1-8(10(5-9)13(15,16)17)6-19-4-3-12(18,7-19)11(20)21/h1-2,5H,3-4,6-7,18H2,(H,20,21) |
| InChIKey | CDVSBDKNYDAJAL-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |