C15H18F4N2O2 — CID 84593093
1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-2-methoxyethanone (PubChem CID 84593093) has the molecular formula C15H18F4N2O2 and a molecular weight of 334.31 g/mol. Its IUPAC name is 1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-2-methoxyethanone.
| Compound Name | 1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-2-methoxyethanone |
|---|---|
| PubChem CID | 84593093 |
| Molecular Formula | C15H18F4N2O2 |
| Molecular Weight | 334.31 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | 1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]-2-methoxyethanone |
| SMILES | COCC(=O)N1CCN(Cc2ccc(F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C15H18F4N2O2/c1-23-10-14(22)21-6-4-20(5-7-21)9-11-2-3-12(16)8-13(11)15(17,18)19/h2-3,8H,4-7,9-10H2,1H3 |
| InChIKey | JFGLBOHWAOFKCK-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |