C21H16Cl2F4N2O — CID 140811861
3-(2,3-dichlorophenyl)-1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-yn-1-one (PubChem CID 140811861) has the molecular formula C21H16Cl2F4N2O and a molecular weight of 459.27 g/mol. Its IUPAC name is 3-(2,3-dichlorophenyl)-1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-yn-1-one.
| Compound Name | 3-(2,3-dichlorophenyl)-1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-yn-1-one |
|---|---|
| PubChem CID | 140811861 |
| Molecular Formula | C21H16Cl2F4N2O |
| Molecular Weight | 459.27 g/mol |
| Exact Mass | 458.06 |
| IUPAC Name | 3-(2,3-dichlorophenyl)-1-[4-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]piperazin-1-yl]prop-2-yn-1-one |
| SMILES | O=C(C#Cc1cccc(Cl)c1Cl)N1CCN(Cc2ccc(F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C21H16Cl2F4N2O/c22-18-3-1-2-14(20(18)23)5-7-19(30)29-10-8-28(9-11-29)13-15-4-6-16(24)12-17(15)21(25,26)27/h1-4,6,12H,8-11,13H2 |
| InChIKey | KQFPURKLPVVMHK-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.27 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|