C16H20F3N3O3 — CID 9429545
2-[4-(2-methoxyacetyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide (PubChem CID 9429545) has the molecular formula C16H20F3N3O3 and a molecular weight of 359.35 g/mol. Its IUPAC name is 2-[4-(2-methoxyacetyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide.
| Compound Name | 2-[4-(2-methoxyacetyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 9429545 |
| Molecular Formula | C16H20F3N3O3 |
| Molecular Weight | 359.35 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | 2-[4-(2-methoxyacetyl)piperazin-1-yl]-N-[2-(trifluoromethyl)phenyl]acetamide |
| SMILES | COCC(=O)N1CCN(CC(=O)Nc2ccccc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H20F3N3O3/c1-25-11-15(24)22-8-6-21(7-9-22)10-14(23)20-13-5-3-2-4-12(13)16(17,18)19/h2-5H,6-11H2,1H3,(H,20,23) |
| InChIKey | ACWOAIGUKBVLMI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |