C8H12F3NO3 — CID 63708729
1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 63708729) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 63708729 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 1-(2-hydroxyethyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | O=C(O)C1(C(F)(F)F)CCN(CCO)C1 |
| InChI | InChI=1S/C8H12F3NO3/c9-8(10,11)7(6(14)15)1-2-12(5-7)3-4-13/h13H,1-5H2,(H,14,15) |
| InChIKey | QZFWSMVIQRTSRX-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |