C11H16F3NO2 — CID 114473180
1-(3-methylbut-3-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid (PubChem CID 114473180) has the molecular formula C11H16F3NO2 and a molecular weight of 251.25 g/mol. Its IUPAC name is 1-(3-methylbut-3-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid.
| Compound Name | 1-(3-methylbut-3-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 114473180 |
| Molecular Formula | C11H16F3NO2 |
| Molecular Weight | 251.25 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-(3-methylbut-3-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxylic acid |
| SMILES | C=C(C)CCN1CCC(C(=O)O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C11H16F3NO2/c1-8(2)3-5-15-6-4-10(7-15,9(16)17)11(12,13)14/h1,3-7H2,2H3,(H,16,17) |
| InChIKey | XLQNTORGHOYPCG-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.25 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|