C12H18N2O2S — CID 43397030
3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoic acid (PubChem CID 43397030) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 43397030 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3-[4-(thiophen-2-ylmethyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CCN1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C12H18N2O2S/c15-12(16)3-4-13-5-7-14(8-6-13)10-11-2-1-9-17-11/h1-2,9H,3-8,10H2,(H,15,16) |
| InChIKey | NMOCLHFBGHMZJS-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |