C16H19N3OS — CID 17185519
N-phenyl-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide (PubChem CID 17185519) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-phenyl-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide.
| Compound Name | N-phenyl-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 17185519 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-phenyl-4-(thiophen-2-ylmethyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccccc1)N1CCN(Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H19N3OS/c20-16(17-14-5-2-1-3-6-14)19-10-8-18(9-11-19)13-15-7-4-12-21-15/h1-7,12H,8-11,13H2,(H,17,20) |
| InChIKey | QXNXASUVDMAXSE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |