C17H20IN3OS — CID 23824710
N-(4-iodophenyl)-4-(2-thiophen-2-ylethyl)piperazine-1-carboxamide (PubChem CID 23824710) has the molecular formula C17H20IN3OS and a molecular weight of 441.34 g/mol. Its IUPAC name is N-(4-iodophenyl)-4-(2-thiophen-2-ylethyl)piperazine-1-carboxamide.
| Compound Name | N-(4-iodophenyl)-4-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 23824710 |
| Molecular Formula | C17H20IN3OS |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | N-(4-iodophenyl)-4-(2-thiophen-2-ylethyl)piperazine-1-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C17H20IN3OS/c18-14-3-5-15(6-4-14)19-17(22)21-11-9-20(10-12-21)8-7-16-2-1-13-23-16/h1-6,13H,7-12H2,(H,19,22) |
| InChIKey | AXLMVZFGDCZCJA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|