C18H21N3O2S2 — CID 5175978
N-(1,3-benzodioxol-5-yl)-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide (PubChem CID 5175978) has the molecular formula C18H21N3O2S2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 5175978 |
| Molecular Formula | C18H21N3O2S2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc2c(c1)OCO2)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C18H21N3O2S2/c24-18(19-14-3-4-16-17(12-14)23-13-22-16)21-9-7-20(8-10-21)6-5-15-2-1-11-25-15/h1-4,11-12H,5-10,13H2,(H,19,24) |
| InChIKey | QIZYPUDAAAJAHZ-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|