C19H24ClN3S2 — CID 3742317
N-[2-(4-chlorophenyl)ethyl]-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide (PubChem CID 3742317) has the molecular formula C19H24ClN3S2 and a molecular weight of 394.01 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3742317 |
| Molecular Formula | C19H24ClN3S2 |
| Molecular Weight | 394.01 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-4-(2-thiophen-2-ylethyl)piperazine-1-carbothioamide |
| SMILES | S=C(NCCc1ccc(Cl)cc1)N1CCN(CCc2cccs2)CC1 |
| InChI | InChI=1S/C19H24ClN3S2/c20-17-5-3-16(4-6-17)7-9-21-19(24)23-13-11-22(12-14-23)10-8-18-2-1-15-25-18/h1-6,15H,7-14H2,(H,21,24) |
| InChIKey | KXCVAZDJWSMKLS-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.01 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|