C19H21ClN2O2S — CID 11574380
N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide (PubChem CID 11574380) has the molecular formula C19H21ClN2O2S and a molecular weight of 376.91 g/mol. Its IUPAC name is N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide.
| Compound Name | N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide |
|---|---|
| PubChem CID | 11574380 |
| Molecular Formula | C19H21ClN2O2S |
| Molecular Weight | 376.91 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | N-[2-(4-chlorophenyl)ethyl]-7,8-dihydroxy-1,2,4,5-tetrahydro-3-benzazepine-3-carbothioamide |
| SMILES | Oc1cc2c(cc1O)CCN(C(=S)NCCc1ccc(Cl)cc1)CC2 |
| InChI | InChI=1S/C19H21ClN2O2S/c20-16-3-1-13(2-4-16)5-8-21-19(25)22-9-6-14-11-17(23)18(24)12-15(14)7-10-22/h1-4,11-12,23-24H,5-10H2,(H,21,25) |
| InChIKey | GFNWWWUJZGWHRQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|