C16H22ClN3OS — CID 3773187
4-acetyl-N-[2-(4-chlorophenyl)ethyl]-1,4-diazepane-1-carbothioamide (PubChem CID 3773187) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is 4-acetyl-N-[2-(4-chlorophenyl)ethyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-acetyl-N-[2-(4-chlorophenyl)ethyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3773187 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-acetyl-N-[2-(4-chlorophenyl)ethyl]-1,4-diazepane-1-carbothioamide |
| SMILES | CC(=O)N1CCCN(C(=S)NCCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClN3OS/c1-13(21)19-9-2-10-20(12-11-19)16(22)18-8-7-14-3-5-15(17)6-4-14/h3-6H,2,7-12H2,1H3,(H,18,22) |
| InChIKey | QVQWMLHHFQFOSM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|