C15H19Cl2N3OS — CID 3866070
4-acetyl-N-[(3,4-dichlorophenyl)methyl]-1,4-diazepane-1-carbothioamide (PubChem CID 3866070) has the molecular formula C15H19Cl2N3OS and a molecular weight of 360.31 g/mol. Its IUPAC name is 4-acetyl-N-[(3,4-dichlorophenyl)methyl]-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-acetyl-N-[(3,4-dichlorophenyl)methyl]-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3866070 |
| Molecular Formula | C15H19Cl2N3OS |
| Molecular Weight | 360.31 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | 4-acetyl-N-[(3,4-dichlorophenyl)methyl]-1,4-diazepane-1-carbothioamide |
| SMILES | CC(=O)N1CCCN(C(=S)NCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H19Cl2N3OS/c1-11(21)19-5-2-6-20(8-7-19)15(22)18-10-12-3-4-13(16)14(17)9-12/h3-4,9H,2,5-8,10H2,1H3,(H,18,22) |
| InChIKey | WKUNWFSCUDACSO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.31 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|