C19H25Cl2N3OS — CID 3754161
4-(cyclohexanecarbonyl)-N-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide (PubChem CID 3754161) has the molecular formula C19H25Cl2N3OS and a molecular weight of 414.40 g/mol. Its IUPAC name is 4-(cyclohexanecarbonyl)-N-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide.
| Compound Name | 4-(cyclohexanecarbonyl)-N-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3754161 |
| Molecular Formula | C19H25Cl2N3OS |
| Molecular Weight | 414.40 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | 4-(cyclohexanecarbonyl)-N-[(3,4-dichlorophenyl)methyl]piperazine-1-carbothioamide |
| SMILES | O=C(C1CCCCC1)N1CCN(C(=S)NCc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C19H25Cl2N3OS/c20-16-7-6-14(12-17(16)21)13-22-19(26)24-10-8-23(9-11-24)18(25)15-4-2-1-3-5-15/h6-7,12,15H,1-5,8-11,13H2,(H,22,26) |
| InChIKey | JWXQHNHIRCXZRM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.40 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|