C17H22ClN3O2S — CID 2208369
N-[(4-chlorophenyl)methyl]-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide (PubChem CID 2208369) has the molecular formula C17H22ClN3O2S and a molecular weight of 367.90 g/mol. Its IUPAC name is N-[(4-chlorophenyl)methyl]-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide.
| Compound Name | N-[(4-chlorophenyl)methyl]-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2208369 |
| Molecular Formula | C17H22ClN3O2S |
| Molecular Weight | 367.90 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[(4-chlorophenyl)methyl]-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide |
| SMILES | O=C([C@@H]1CCCO1)N1CCN(C(=S)NCc2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C17H22ClN3O2S/c18-14-5-3-13(4-6-14)12-19-17(24)21-9-7-20(8-10-21)16(22)15-2-1-11-23-15/h3-6,15H,1-2,7-12H2,(H,19,24)/t15-/m0/s1 |
| InChIKey | RLDWNHWOCNPEBM-HNNXBMFYSA-N |
| XLogP | 2.04 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.90 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|