C16H20BrN3O2S — CID 1301971
N-(4-bromophenyl)-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide (PubChem CID 1301971) has the molecular formula C16H20BrN3O2S and a molecular weight of 398.33 g/mol. Its IUPAC name is N-(4-bromophenyl)-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-bromophenyl)-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 1301971 |
| Molecular Formula | C16H20BrN3O2S |
| Molecular Weight | 398.33 g/mol |
| Exact Mass | 397.05 |
| IUPAC Name | N-(4-bromophenyl)-4-[(2S)-oxolane-2-carbonyl]piperazine-1-carbothioamide |
| SMILES | O=C([C@@H]1CCCO1)N1CCN(C(=S)Nc2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C16H20BrN3O2S/c17-12-3-5-13(6-4-12)18-16(23)20-9-7-19(8-10-20)15(21)14-2-1-11-22-14/h3-6,14H,1-2,7-11H2,(H,18,23)/t14-/m0/s1 |
| InChIKey | VPPGTIUILABMHG-AWEZNQCLSA-N |
| XLogP | 2.47 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|