C16H19ClFN3O2S — CID 2030671
N-(3-chloro-4-fluorophenyl)-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carbothioamide (PubChem CID 2030671) has the molecular formula C16H19ClFN3O2S and a molecular weight of 371.87 g/mol. Its IUPAC name is N-(3-chloro-4-fluorophenyl)-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carbothioamide.
| Compound Name | N-(3-chloro-4-fluorophenyl)-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2030671 |
| Molecular Formula | C16H19ClFN3O2S |
| Molecular Weight | 371.87 g/mol |
| Exact Mass | 371.09 |
| IUPAC Name | N-(3-chloro-4-fluorophenyl)-4-[(2R)-oxolane-2-carbonyl]piperazine-1-carbothioamide |
| SMILES | O=C([C@H]1CCCO1)N1CCN(C(=S)Nc2ccc(F)c(Cl)c2)CC1 |
| InChI | InChI=1S/C16H19ClFN3O2S/c17-12-10-11(3-4-13(12)18)19-16(24)21-7-5-20(6-8-21)15(22)14-2-1-9-23-14/h3-4,10,14H,1-2,5-9H2,(H,19,24)/t14-/m1/s1 |
| InChIKey | SMPXBGMSYNGXDF-CQSZACIVSA-N |
| XLogP | 2.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.87 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|