C16H19F2N3O2S — CID 2986376
N-(3,5-difluorophenyl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 2986376) has the molecular formula C16H19F2N3O2S and a molecular weight of 355.41 g/mol. Its IUPAC name is N-(3,5-difluorophenyl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-(3,5-difluorophenyl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2986376 |
| Molecular Formula | C16H19F2N3O2S |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | N-(3,5-difluorophenyl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | O=C(C1CCCO1)N1CCN(C(=S)Nc2cc(F)cc(F)c2)CC1 |
| InChI | InChI=1S/C16H19F2N3O2S/c17-11-8-12(18)10-13(9-11)19-16(24)21-5-3-20(4-6-21)15(22)14-2-1-7-23-14/h8-10,14H,1-7H2,(H,19,24) |
| InChIKey | BXJWVEUTMNNERX-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|