C18H23N3O4S — CID 3867871
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide (PubChem CID 3867871) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3867871 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-(oxolane-2-carbonyl)piperazine-1-carbothioamide |
| SMILES | O=C(C1CCCO1)N1CCN(C(=S)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C18H23N3O4S/c22-17(15-2-1-9-23-15)20-5-7-21(8-6-20)18(26)19-13-3-4-14-16(12-13)25-11-10-24-14/h3-4,12,15H,1-2,5-11H2,(H,19,26) |
| InChIKey | PMLUZZCPLOUBSF-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|