C16H21N3O3S — CID 3695781
4-acetyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepane-1-carbothioamide (PubChem CID 3695781) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-acetyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepane-1-carbothioamide.
| Compound Name | 4-acetyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepane-1-carbothioamide |
|---|---|
| PubChem CID | 3695781 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-acetyl-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,4-diazepane-1-carbothioamide |
| SMILES | CC(=O)N1CCCN(C(=S)Nc2ccc3c(c2)OCCO3)CC1 |
| InChI | InChI=1S/C16H21N3O3S/c1-12(20)18-5-2-6-19(8-7-18)16(23)17-13-3-4-14-15(11-13)22-10-9-21-14/h3-4,11H,2,5-10H2,1H3,(H,17,23) |
| InChIKey | BTAIBLNIFMAWSP-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|