C18H20N4O2S — CID 17375184
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylpiperazine-1-carbothioamide (PubChem CID 17375184) has the molecular formula C18H20N4O2S and a molecular weight of 356.45 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 17375184 |
| Molecular Formula | C18H20N4O2S |
| Molecular Weight | 356.45 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-4-pyridin-2-ylpiperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc2c(c1)OCCO2)N1CCN(c2ccccn2)CC1 |
| InChI | InChI=1S/C18H20N4O2S/c25-18(20-14-4-5-15-16(13-14)24-12-11-23-15)22-9-7-21(8-10-22)17-3-1-2-6-19-17/h1-6,13H,7-12H2,(H,20,25) |
| InChIKey | FTINODFYMDEAGN-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.45 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|