C18H18Cl2N4O2S — CID 23912933
4-(3,5-dichloro-4-pyridinyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide (PubChem CID 23912933) has the molecular formula C18H18Cl2N4O2S and a molecular weight of 425.34 g/mol. Its IUPAC name is 4-(3,5-dichloro-4-pyridinyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide.
| Compound Name | 4-(3,5-dichloro-4-pyridinyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 23912933 |
| Molecular Formula | C18H18Cl2N4O2S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.05 |
| IUPAC Name | 4-(3,5-dichloro-4-pyridinyl)-N-(2,3-dihydro-1,4-benzodioxin-6-yl)piperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc2c(c1)OCCO2)N1CCN(c2c(Cl)cncc2Cl)CC1 |
| InChI | InChI=1S/C18H18Cl2N4O2S/c19-13-10-21-11-14(20)17(13)23-3-5-24(6-4-23)18(27)22-12-1-2-15-16(9-12)26-8-7-25-15/h1-2,9-11H,3-8H2,(H,22,27) |
| InChIKey | MBFFMERZIUOLCT-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 49.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|