C15H15Cl2N5S — CID 3600467
N-(3,4-dichlorophenyl)-4-pyrazin-2-ylpiperazine-1-carbothioamide (PubChem CID 3600467) has the molecular formula C15H15Cl2N5S and a molecular weight of 368.29 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-pyrazin-2-ylpiperazine-1-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-pyrazin-2-ylpiperazine-1-carbothioamide |
|---|---|
| PubChem CID | 3600467 |
| Molecular Formula | C15H15Cl2N5S |
| Molecular Weight | 368.29 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-pyrazin-2-ylpiperazine-1-carbothioamide |
| SMILES | S=C(Nc1ccc(Cl)c(Cl)c1)N1CCN(c2cnccn2)CC1 |
| InChI | InChI=1S/C15H15Cl2N5S/c16-12-2-1-11(9-13(12)17)20-15(23)22-7-5-21(6-8-22)14-10-18-3-4-19-14/h1-4,9-10H,5-8H2,(H,20,23) |
| InChIKey | HRELXQWWFAXBQA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|