C16H15Cl2N5O2S — CID 2795847
N-(3,4-dichlorophenyl)-4-(5-nitro-2-pyridinyl)piperazine-1-carbothioamide (PubChem CID 2795847) has the molecular formula C16H15Cl2N5O2S and a molecular weight of 412.30 g/mol. Its IUPAC name is N-(3,4-dichlorophenyl)-4-(5-nitro-2-pyridinyl)piperazine-1-carbothioamide.
| Compound Name | N-(3,4-dichlorophenyl)-4-(5-nitro-2-pyridinyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 2795847 |
| Molecular Formula | C16H15Cl2N5O2S |
| Molecular Weight | 412.30 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(3,4-dichlorophenyl)-4-(5-nitro-2-pyridinyl)piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(N2CCN(C(=S)Nc3ccc(Cl)c(Cl)c3)CC2)nc1 |
| InChI | InChI=1S/C16H15Cl2N5O2S/c17-13-3-1-11(9-14(13)18)20-16(26)22-7-5-21(6-8-22)15-4-2-12(10-19-15)23(24)25/h1-4,9-10H,5-8H2,(H,20,26) |
| InChIKey | HOBPIWXSMFTYDZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.30 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|