C17H16F3N5O2S — CID 175020959
N-(4-nitrophenyl)-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide (PubChem CID 175020959) has the molecular formula C17H16F3N5O2S and a molecular weight of 411.41 g/mol. Its IUPAC name is N-(4-nitrophenyl)-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-nitrophenyl)-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 175020959 |
| Molecular Formula | C17H16F3N5O2S |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | N-(4-nitrophenyl)-4-[6-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
| SMILES | O=[N+]([O-])c1ccc(NC(=S)N2CCN(c3cccc(C(F)(F)F)n3)CC2)cc1 |
| InChI | InChI=1S/C17H16F3N5O2S/c18-17(19,20)14-2-1-3-15(22-14)23-8-10-24(11-9-23)16(28)21-12-4-6-13(7-5-12)25(26)27/h1-7H,8-11H2,(H,21,28) |
| InChIKey | RTQSOZFEEHWXLO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 74.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|