C18H19F3N4S — CID 4842429
N-(4-methylphenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide (PubChem CID 4842429) has the molecular formula C18H19F3N4S and a molecular weight of 380.44 g/mol. Its IUPAC name is N-(4-methylphenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide.
| Compound Name | N-(4-methylphenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 4842429 |
| Molecular Formula | C18H19F3N4S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | N-(4-methylphenyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
| SMILES | Cc1ccc(NC(=S)N2CCN(c3ccc(C(F)(F)F)cn3)CC2)cc1 |
| InChI | InChI=1S/C18H19F3N4S/c1-13-2-5-15(6-3-13)23-17(26)25-10-8-24(9-11-25)16-7-4-14(12-22-16)18(19,20)21/h2-7,12H,8-11H2,1H3,(H,23,26) |
| InChIKey | CCFINXPRQUUCSF-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|