C18H25F3N4S — CID 8789877
N-[(1R,2R)-2-methylcyclohexyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide (PubChem CID 8789877) has the molecular formula C18H25F3N4S and a molecular weight of 386.49 g/mol. Its IUPAC name is N-[(1R,2R)-2-methylcyclohexyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide.
| Compound Name | N-[(1R,2R)-2-methylcyclohexyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8789877 |
| Molecular Formula | C18H25F3N4S |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | N-[(1R,2R)-2-methylcyclohexyl]-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
| SMILES | C[C@@H]1CCCC[C@H]1NC(=S)N1CCN(c2ccc(C(F)(F)F)cn2)CC1 |
| InChI | InChI=1S/C18H25F3N4S/c1-13-4-2-3-5-15(13)23-17(26)25-10-8-24(9-11-25)16-7-6-14(12-22-16)18(19,20)21/h6-7,12-13,15H,2-5,8-11H2,1H3,(H,23,26)/t13-,15-/m1/s1 |
| InChIKey | BJMNZNPKSNNSPD-UKRRQHHQSA-N |
| XLogP | 3.68 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|