C16H21F3N4OS — CID 46800492
N-(oxolan-2-ylmethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide (PubChem CID 46800492) has the molecular formula C16H21F3N4OS and a molecular weight of 374.43 g/mol. Its IUPAC name is N-(oxolan-2-ylmethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide.
| Compound Name | N-(oxolan-2-ylmethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 46800492 |
| Molecular Formula | C16H21F3N4OS |
| Molecular Weight | 374.43 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | N-(oxolan-2-ylmethyl)-4-[5-(trifluoromethyl)-2-pyridinyl]piperazine-1-carbothioamide |
| SMILES | FC(F)(F)c1ccc(N2CCN(C(=S)NCC3CCCO3)CC2)nc1 |
| InChI | InChI=1S/C16H21F3N4OS/c17-16(18,19)12-3-4-14(20-10-12)22-5-7-23(8-6-22)15(25)21-11-13-2-1-9-24-13/h3-4,10,13H,1-2,5-9,11H2,(H,21,25) |
| InChIKey | CXNZAKGZMLHZMO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 40.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.43 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|