C16H22ClN3OS — CID 19654469
4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide (PubChem CID 19654469) has the molecular formula C16H22ClN3OS and a molecular weight of 339.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 19654469 |
| Molecular Formula | C16H22ClN3OS |
| Molecular Weight | 339.89 g/mol |
| Exact Mass | 339.12 |
| IUPAC Name | 4-(4-chlorophenyl)-N-(oxolan-2-ylmethyl)piperazine-1-carbothioamide |
| SMILES | S=C(NCC1CCCO1)N1CCN(c2ccc(Cl)cc2)CC1 |
| InChI | InChI=1S/C16H22ClN3OS/c17-13-3-5-14(6-4-13)19-7-9-20(10-8-19)16(22)18-12-15-2-1-11-21-15/h3-6,15H,1-2,7-12H2,(H,18,22) |
| InChIKey | ORLACXMJVJMUSZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 27.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|