C23H28ClN3O2 — CID 92987604
3-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 92987604) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 3-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 92987604 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 3-[[4-(4-chlorophenyl)piperazin-1-yl]methyl]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | O=C(NC[C@@H]1CCCO1)c1cccc(CN2CCN(c3ccc(Cl)cc3)CC2)c1 |
| InChI | InChI=1S/C23H28ClN3O2/c24-20-6-8-21(9-7-20)27-12-10-26(11-13-27)17-18-3-1-4-19(15-18)23(28)25-16-22-5-2-14-29-22/h1,3-4,6-9,15,22H,2,5,10-14,16-17H2,(H,25,28)/t22-/m0/s1 |
| InChIKey | MDNXPTLNDJJHFQ-QFIPXVFZSA-N |
| XLogP | 3.57 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |