C23H27N3O3 — CID 50814389
3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 50814389) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is 3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 50814389 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | 3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | O=C(NCC1CCCO1)c1cccc(N2CCCN(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C23H27N3O3/c27-22(24-16-21-11-5-14-29-21)19-9-4-10-20(15-19)26-13-6-12-25(23(26)28)17-18-7-2-1-3-8-18/h1-4,7-10,15,21H,5-6,11-14,16-17H2,(H,24,27) |
| InChIKey | ATTYZUUSDBCJAR-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |