C26H25N3O4 — CID 50814326
methyl 2-[[3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)benzoyl]amino]benzoate (PubChem CID 50814326) has the molecular formula C26H25N3O4 and a molecular weight of 443.50 g/mol. Its IUPAC name is methyl 2-[[3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)benzoyl]amino]benzoate.
| Compound Name | methyl 2-[[3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)benzoyl]amino]benzoate |
|---|---|
| PubChem CID | 50814326 |
| Molecular Formula | C26H25N3O4 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.18 |
| IUPAC Name | methyl 2-[[3-(3-benzyl-2-oxo-1,3-diazinan-1-yl)benzoyl]amino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccc(N2CCCN(Cc3ccccc3)C2=O)c1 |
| InChI | InChI=1S/C26H25N3O4/c1-33-25(31)22-13-5-6-14-23(22)27-24(30)20-11-7-12-21(17-20)29-16-8-15-28(26(29)32)18-19-9-3-2-4-10-19/h2-7,9-14,17H,8,15-16,18H2,1H3,(H,27,30) |
| InChIKey | IQPPYBWLOHEFOO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |