C25H25N3O3 — CID 46156673
N-[4-[3-[(3-methoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide (PubChem CID 46156673) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is N-[4-[3-[(3-methoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide.
| Compound Name | N-[4-[3-[(3-methoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 46156673 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | N-[4-[3-[(3-methoxyphenyl)methyl]-2-oxo-1,3-diazinan-1-yl]phenyl]benzamide |
| SMILES | COc1cccc(CN2CCCN(c3ccc(NC(=O)c4ccccc4)cc3)C2=O)c1 |
| InChI | InChI=1S/C25H25N3O3/c1-31-23-10-5-7-19(17-23)18-27-15-6-16-28(25(27)30)22-13-11-21(12-14-22)26-24(29)20-8-3-2-4-9-20/h2-5,7-14,17H,6,15-16,18H2,1H3,(H,26,29) |
| InChIKey | POVQALOXEQPRJZ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |