C25H26N4O3 — CID 46070693
1-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-3-(3-methoxyphenyl)urea (PubChem CID 46070693) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 1-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-3-(3-methoxyphenyl)urea.
| Compound Name | 1-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-3-(3-methoxyphenyl)urea |
|---|---|
| PubChem CID | 46070693 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 1-[4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)phenyl]-3-(3-methoxyphenyl)urea |
| SMILES | COc1cccc(NC(=O)Nc2ccc(N3CCCN(Cc4ccccc4)C3=O)cc2)c1 |
| InChI | InChI=1S/C25H26N4O3/c1-32-23-10-5-9-21(17-23)27-24(30)26-20-11-13-22(14-12-20)29-16-6-15-28(25(29)31)18-19-7-3-2-4-8-19/h2-5,7-14,17H,6,15-16,18H2,1H3,(H2,26,27,30) |
| InChIKey | JUWOWSDBKZXYEH-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |