C25H24ClN3O3 — CID 42869693
N-[5-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-2-chlorophenyl]-4-methoxybenzamide (PubChem CID 42869693) has the molecular formula C25H24ClN3O3 and a molecular weight of 449.94 g/mol. Its IUPAC name is N-[5-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-2-chlorophenyl]-4-methoxybenzamide.
| Compound Name | N-[5-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-2-chlorophenyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 42869693 |
| Molecular Formula | C25H24ClN3O3 |
| Molecular Weight | 449.94 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | N-[5-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-2-chlorophenyl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)Nc2cc(N3CCCN(Cc4ccccc4)C3=O)ccc2Cl)cc1 |
| InChI | InChI=1S/C25H24ClN3O3/c1-32-21-11-8-19(9-12-21)24(30)27-23-16-20(10-13-22(23)26)29-15-5-14-28(25(29)31)17-18-6-3-2-4-7-18/h2-4,6-13,16H,5,14-15,17H2,1H3,(H,27,30) |
| InChIKey | RRVUMTYZZIZRLL-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.94 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |