C26H27N3O3 — CID 50754372
4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(2-ethoxyphenyl)benzamide (PubChem CID 50754372) has the molecular formula C26H27N3O3 and a molecular weight of 429.52 g/mol. Its IUPAC name is 4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(2-ethoxyphenyl)benzamide.
| Compound Name | 4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 50754372 |
| Molecular Formula | C26H27N3O3 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 4-(3-benzyl-2-oxo-1,3-diazinan-1-yl)-N-(2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(N2CCCN(Cc3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C26H27N3O3/c1-2-32-24-12-7-6-11-23(24)27-25(30)21-13-15-22(16-14-21)29-18-8-17-28(26(29)31)19-20-9-4-3-5-10-20/h3-7,9-16H,2,8,17-19H2,1H3,(H,27,30) |
| InChIKey | PTBCLJBKJSXRGY-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |