C25H24N2O3S — CID 3138297
4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-ethoxyphenyl)benzamide (PubChem CID 3138297) has the molecular formula C25H24N2O3S and a molecular weight of 432.55 g/mol. Its IUPAC name is 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-ethoxyphenyl)benzamide.
| Compound Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-ethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 3138297 |
| Molecular Formula | C25H24N2O3S |
| Molecular Weight | 432.55 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | 4-(3-benzyl-4-oxo-1,3-thiazolidin-2-yl)-N-(2-ethoxyphenyl)benzamide |
| SMILES | CCOc1ccccc1NC(=O)c1ccc(C2SCC(=O)N2Cc2ccccc2)cc1 |
| InChI | InChI=1S/C25H24N2O3S/c1-2-30-22-11-7-6-10-21(22)26-24(29)19-12-14-20(15-13-19)25-27(23(28)17-31-25)16-18-8-4-3-5-9-18/h3-15,25H,2,16-17H2,1H3,(H,26,29) |
| InChIKey | BUFUREVKUZXQEC-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |